N-Acetoxy-N-acetylcarbamic acid ethyl ester
N-Acetoxy-N-acetylcarbamic acid ethyl ester structure
|
Common Name | N-Acetoxy-N-acetylcarbamic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2139-93-7 | Molecular Weight | 189.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [acetyl(ethoxycarbonyl)amino] acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H11NO5 |
|---|---|
| Molecular Weight | 189.16600 |
| Exact Mass | 189.06400 |
| PSA | 72.91000 |
| LogP | 0.46950 |
| InChIKey | GGCXFPBIKZXKFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(OC(C)=O)C(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 1 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Acetyl-N-aethoxycarbonyl-O-acetyl-hydroxylamin |
| N,O-Diacetyl-N-carboxyhydroxylamine ethyl ester |
| Diacetylhydroxyurethane |
| N-Acetoxy-N-acetyl-carbaminsaeure-aethylester |
| N-carboxyethyl-N,O-diacetyl hydroxylamine |
| N,O-Diacetyl-N-hydroxyurethan |
| Hydroxylamine,N,O-diacetyl-N-carboxy-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: The English name of [acetyl(ethoxycarbonyl)amino] acetate is [acetyl(ethoxycarbonyl)amino] acetate. |
| Q: What is the InChIKey of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: InChIKey of [acetyl(ethoxycarbonyl)amino] acetate is GGCXFPBIKZXKFS-UHFFFAOYSA-N. |
| Q: What is the LogP of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: LogP of [acetyl(ethoxycarbonyl)amino] acetate is 0.46950. |
| Q: What is the SMILES notation of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: SMILES notation of [acetyl(ethoxycarbonyl)amino] acetate is CCOC(=O)N(OC(C)=O)C(C)=O. |
| Q: What is the molecular weight of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: Molecular weight of [acetyl(ethoxycarbonyl)amino] acetate is 189.16600. |
| Q: What is the Chinese name of 2139-93-7? |
| A: Chinese name of 2139-93-7 is 2139-93-7. |
| Q: What is the polar surface area (PSA) of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: Polar surface area (PSA) of [acetyl(ethoxycarbonyl)amino] acetate is 72.91000. |
| Q: What is the CAS number of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: CAS number of [acetyl(ethoxycarbonyl)amino] acetate is 2139-93-7. |
| Q: What are the downstream products of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: Related downstream products(CAS) of [acetyl(ethoxycarbonyl)amino] acetate: 17720-63-7. |
| Q: What is the molecular formula of [acetyl(ethoxycarbonyl)amino] acetate? |
| A: Molecular formula of [acetyl(ethoxycarbonyl)amino] acetate is C7H11NO5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |