2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid
Modify Date: 2026-09-28 16:46:14
![2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid Structure](https://www.chemsrc.com/extcaspic/277/2139089-59-9.png)
2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid structure
|
Common Name | 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2139089-59-9 | Molecular Weight | 247.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H21NO5 |
|---|---|
| Molecular Weight | 247.29 |
| InChIKey | GFRSMUIEZUFHJT-UHFFFAOYSA-N |
| SMILES | CCC(O)CC(NC(=O)OC(C)(C)C)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid? |
| A: Molecular weight of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid is 247.29. |
| Q: What is the molecular formula of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid? |
| A: Molecular formula of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid is C11H21NO5. |
| Q: What is the CAS number of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid? |
| A: CAS number of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid is 2139089-59-9. |
| Q: What is the English name of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid? |
| A: The English name of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid is 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid. |
| Q: What is the Chinese name of 2139089-59-9? |
| A: Chinese name of 2139089-59-9 is 2139089-59-9. |
| Q: What is the SMILES notation of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid? |
| A: SMILES notation of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid is CCC(O)CC(NC(=O)OC(C)(C)C)C(=O)O. |
| Q: What is the InChIKey of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid? |
| A: InChIKey of 2-{[(Tert-butoxy)carbonyl]amino}-4-hydroxyhexanoic acid is GFRSMUIEZUFHJT-UHFFFAOYSA-N. |