Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate structure
|
Common Name | Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2139149-92-9 | Molecular Weight | 236.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13ClN2O4 |
|---|---|
| Molecular Weight | 236.65 |
| InChIKey | ZPWQFWCJTUAIPH-UHFFFAOYSA-N |
| SMILES | NC(=O)C1(O)CCCN(C(=O)OCCl)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate? |
| A: Molecular weight of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate is 236.65. |
| Q: What is the molecular formula of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate? |
| A: Molecular formula of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate is C8H13ClN2O4. |
| Q: What is the English name of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate? |
| A: The English name of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate is Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate. |
| Q: What is the SMILES notation of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate? |
| A: SMILES notation of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate is NC(=O)C1(O)CCCN(C(=O)OCCl)C1. |
| Q: What is the CAS number of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate? |
| A: CAS number of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate is 2139149-92-9. |
| Q: What is the InChIKey of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate? |
| A: InChIKey of Chloromethyl 3-carbamoyl-3-hydroxypiperidine-1-carboxylate is ZPWQFWCJTUAIPH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2139149-92-9? |
| A: Chinese name of 2139149-92-9 is 2139149-92-9. |