6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one
Modify Date: 2026-08-09 10:51:30
6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one structure
|
Common Name | 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 2139236-07-8 | Molecular Weight | 170.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H10N4O2 |
|---|---|
| Molecular Weight | 170.17 |
| InChIKey | UZTAQYKTZQKPNZ-UHFFFAOYSA-N |
| SMILES | CC(N)Cc1nc(=O)[nH]c(=O)[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2139236-07-8? |
| A: Chinese name of 2139236-07-8 is 2139236-07-8. |
| Q: What is the SMILES notation of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one? |
| A: SMILES notation of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one is CC(N)Cc1nc(=O)[nH]c(=O)[nH]1. |
| Q: What is the InChIKey of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one? |
| A: InChIKey of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one is UZTAQYKTZQKPNZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one? |
| A: Molecular formula of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one is C6H10N4O2. |
| Q: What is the molecular weight of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one? |
| A: Molecular weight of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one is 170.17. |
| Q: What is the English name of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one? |
| A: The English name of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one is 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one. |
| Q: What is the CAS number of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one? |
| A: CAS number of 6-(2-Aminopropyl)-4-hydroxy-1,2-dihydro-1,3,5-triazin-2-one is 2139236-07-8. |