Hydrocodone aldol dimer
Modify Date: 2025-09-03 19:21:45
Hydrocodone aldol dimer structure
|
Common Name | Hydrocodone aldol dimer | ||
|---|---|---|---|---|
| CAS Number | 2139239-97-5 | Molecular Weight | 598.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H42N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hydrocodone aldol dimer |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H42N2O6 |
|---|---|
| Molecular Weight | 598.7 |
| InChIKey | RHEYPXQDDDRWEY-QOFXUFJWSA-N |
| SMILES | COc1ccc2c3c1OC1C(=O)C(C4(O)CCC5C6Cc7ccc(OC)c8c7C5(CCN6C)C4O8)CC4C(C2)N(C)CCC314 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Hydrocodone aldol dimer? |
| A: Molecular weight of Hydrocodone aldol dimer is 598.7. |
| Q: What is the CAS number of Hydrocodone aldol dimer? |
| A: CAS number of Hydrocodone aldol dimer is 2139239-97-5. |
| Q: What is the SMILES notation of Hydrocodone aldol dimer? |
| A: SMILES notation of Hydrocodone aldol dimer is COc1ccc2c3c1OC1C(=O)C(C4(O)CCC5C6Cc7ccc(OC)c8c7C5(CCN6C)C4O8)CC4C(C2)N(C)CCC314. |
| Q: What is the Chinese name of 2139239-97-5? |
| A: Chinese name of 2139239-97-5 is 2139239-97-5. |
| Q: What is the English name of Hydrocodone aldol dimer? |
| A: The English name of Hydrocodone aldol dimer is Hydrocodone aldol dimer. |
| Q: What is the InChIKey of Hydrocodone aldol dimer? |
| A: InChIKey of Hydrocodone aldol dimer is RHEYPXQDDDRWEY-QOFXUFJWSA-N. |
| Q: What is the molecular formula of Hydrocodone aldol dimer? |
| A: Molecular formula of Hydrocodone aldol dimer is C36H42N2O6. |