Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate
Modify Date: 2026-07-07 11:28:31
Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate structure
|
Common Name | Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2139592-76-8 | Molecular Weight | 215.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H21NO3 |
|---|---|
| Molecular Weight | 215.29 |
| InChIKey | IDQIDOPLTYEHDL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(C(C)(C)O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate? |
| A: CAS number of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate is 2139592-76-8. |
| Q: What is the English name of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate? |
| A: The English name of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate is Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate. |
| Q: What is the Chinese name of 2139592-76-8? |
| A: Chinese name of 2139592-76-8 is 2139592-76-8. |
| Q: What is the InChIKey of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate? |
| A: InChIKey of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate is IDQIDOPLTYEHDL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate? |
| A: Molecular formula of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate is C11H21NO3. |
| Q: What is the SMILES notation of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate? |
| A: SMILES notation of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate is CCOC(=O)N1CCC(C(C)(C)O)CC1. |
| Q: What is the molecular weight of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate? |
| A: Molecular weight of Ethyl 4-(2-hydroxypropan-2-yl)piperidine-1-carboxylate is 215.29. |