N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide
Modify Date: 2026-08-19 13:34:28
N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide structure
|
Common Name | N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2139646-75-4 | Molecular Weight | 235.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H17N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H17N3O3S |
|---|---|
| Molecular Weight | 235.31 |
| InChIKey | NERUGSDXQIGHDO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N1CCC(S(N)(=O)=O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide? |
| A: CAS number of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide is 2139646-75-4. |
| Q: What is the English name of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide? |
| A: The English name of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide is N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide. |
| Q: What is the molecular formula of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide? |
| A: Molecular formula of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide is C8H17N3O3S. |
| Q: What is the SMILES notation of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide? |
| A: SMILES notation of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide is CN(C)C(=O)N1CCC(S(N)(=O)=O)CC1. |
| Q: What is the molecular weight of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide? |
| A: Molecular weight of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide is 235.31. |
| Q: What is the InChIKey of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide? |
| A: InChIKey of N,N-dimethyl-4-sulfamoylpiperidine-1-carboxamide is NERUGSDXQIGHDO-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2139646-75-4? |
| A: Chinese name of 2139646-75-4 is 2139646-75-4. |