2,3-Dihydroxy-6,7-dimethyl-4-propyl-1-naphthoic acid
Modify Date: 2025-09-02 08:58:32
2,3-Dihydroxy-6,7-dimethyl-4-propyl-1-naphthoic acid structure
|
Common Name | 2,3-Dihydroxy-6,7-dimethyl-4-propyl-1-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 213971-33-6 | Molecular Weight | 274.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3-Dihydroxy-6,7-dimethyl-4-propyl-1-naphthoic acid |
|---|
| Molecular Formula | C16H18O4 |
|---|---|
| Molecular Weight | 274.31 |
| InChIKey | QYDDTEVBIYQMGD-UHFFFAOYSA-N |
| SMILES | CCCc1c(O)c(O)c(C(=O)O)c2cc(C)c(C)cc12 |
|
Name: Competitive inhibition of human LDH5 in presence of NADH
Source: ChEMBL
Target: L-lactate dehydrogenase A chain
External Id: CHEMBL3768756
|
|
Name: Competitive inhibition of human LDH1 in presence of NADH
Source: ChEMBL
Target: L-lactate dehydrogenase B chain
External Id: CHEMBL3768757
|
Total 2, Current Page 1 of 1
1