6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene
Modify Date: 2025-11-03 09:10:16
6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene structure
|
Common Name | 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene | ||
|---|---|---|---|---|
| CAS Number | 213971-39-2 | Molecular Weight | 323.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19BrO2 |
|---|---|
| Molecular Weight | 323.22 |
| InChIKey | AXLOROQPFOSIIH-UHFFFAOYSA-N |
| SMILES | CCCc1c(OC)c(OC)cc2cc(Br)c(C)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene? |
| A: Molecular weight of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene is 323.22. |
| Q: What is the molecular formula of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene? |
| A: Molecular formula of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene is C16H19BrO2. |
| Q: What is the English name of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene? |
| A: The English name of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene is 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene. |
| Q: What is the CAS number of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene? |
| A: CAS number of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene is 213971-39-2. |
| Q: What is the InChIKey of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene? |
| A: InChIKey of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene is AXLOROQPFOSIIH-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 213971-39-2? |
| A: Chinese name of 213971-39-2 is 213971-39-2. |
| Q: What is the SMILES notation of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene? |
| A: SMILES notation of 6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene is CCCc1c(OC)c(OC)cc2cc(Br)c(C)cc12. |