2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid
Modify Date: 2026-07-13 07:01:07
![2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid Structure](https://www.chemsrc.com/extcaspic/284/2139809-67-7.png)
2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid structure
|
Common Name | 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2139809-67-7 | Molecular Weight | 291.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21NO4 |
|---|---|
| Molecular Weight | 291.34 |
| InChIKey | ZDGRQUXLRGSZAT-UHFFFAOYSA-N |
| SMILES | CC1CCCC1(CC(=O)O)NC(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid? |
| A: Molecular weight of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid is 291.34. |
| Q: What is the English name of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid? |
| A: The English name of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid is 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid. |
| Q: What is the molecular formula of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid? |
| A: Molecular formula of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid is C16H21NO4. |
| Q: What is the Chinese name of 2139809-67-7? |
| A: Chinese name of 2139809-67-7 is 2139809-67-7. |
| Q: What is the CAS number of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid? |
| A: CAS number of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid is 2139809-67-7. |
| Q: What is the InChIKey of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid? |
| A: InChIKey of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid is ZDGRQUXLRGSZAT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid? |
| A: SMILES notation of 2-(1-{[(Benzyloxy)carbonyl]amino}-2-methylcyclopentyl)acetic acid is CC1CCCC1(CC(=O)O)NC(=O)OCc1ccccc1. |