3-Methyluridine structure
|
Common Name | 3-Methyluridine | ||
|---|---|---|---|---|
| CAS Number | 2140-69-4 | Molecular Weight | 258.228 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 501.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C10H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8±32.9 °C | |
Use of 3-Methyluridine3-Methyluridine is a modified nucleoside of cellular RNA. |
| Name | N-3-Methyluridine |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Methyluridine is a modified nucleoside of cellular RNA. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.1±60.0 °C at 760 mmHg |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.228 |
| Flash Point | 256.8±32.9 °C |
| Exact Mass | 258.085175 |
| PSA | 113.92000 |
| LogP | -0.02 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | UTQUILVPBZEHTK-ZITKLIBNSA-N |
| SMILES | Cn1c(=O)ccn(C2OC(CO)C(O)C2O)c1=O |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 3-methyl-1-pentofuranosylpyrimidine-2,4(1H,3H)-dione |
| 3-Methyl-uridin |
| 3-Methyluridine |
| 3-Methyl-1-pentofuranosyl-2,4(1H,3H)-pyrimidinedione |