Fenthion-oxon-sulfone D3 (S-methyl D3)
Modify Date: 2025-09-09 19:00:19
Fenthion-oxon-sulfone D3 (S-methyl D3) structure
|
Common Name | Fenthion-oxon-sulfone D3 (S-methyl D3) | ||
|---|---|---|---|---|
| CAS Number | 2140327-44-0 | Molecular Weight | 297.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15O6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Fenthion-oxon-sulfone D3 (S-methyl D3) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15O6PS |
|---|---|
| Molecular Weight | 297.28 |
| InChIKey | VUTHWSUXEOILTN-GKOSEXJESA-N |
| SMILES | COP(=O)(OC)Oc1ccc(S(C)(=O)=O)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Fenthion-oxon-sulfone D3 (S-methyl D3)? |
| A: CAS number of Fenthion-oxon-sulfone D3 (S-methyl D3) is 2140327-44-0. |
| Q: What is the English name of Fenthion-oxon-sulfone D3 (S-methyl D3)? |
| A: The English name of Fenthion-oxon-sulfone D3 (S-methyl D3) is Fenthion-oxon-sulfone D3 (S-methyl D3). |
| Q: What is the molecular weight of Fenthion-oxon-sulfone D3 (S-methyl D3)? |
| A: Molecular weight of Fenthion-oxon-sulfone D3 (S-methyl D3) is 297.28. |
| Q: What is the InChIKey of Fenthion-oxon-sulfone D3 (S-methyl D3)? |
| A: InChIKey of Fenthion-oxon-sulfone D3 (S-methyl D3) is VUTHWSUXEOILTN-GKOSEXJESA-N. |
| Q: What is the molecular formula of Fenthion-oxon-sulfone D3 (S-methyl D3)? |
| A: Molecular formula of Fenthion-oxon-sulfone D3 (S-methyl D3) is C10H15O6PS. |
| Q: What is the Chinese name of 2140327-44-0? |
| A: Chinese name of 2140327-44-0 is 2140327-44-0. |
| Q: What is the SMILES notation of Fenthion-oxon-sulfone D3 (S-methyl D3)? |
| A: SMILES notation of Fenthion-oxon-sulfone D3 (S-methyl D3) is COP(=O)(OC)Oc1ccc(S(C)(=O)=O)c(C)c1. |