Cycloprocanazole-d3
Modify Date: 2026-07-15 20:18:38
Cycloprocanazole-d3 structure
|
Common Name | Cycloprocanazole-d3 | ||
|---|---|---|---|---|
| CAS Number | 2140327-52-0 | Molecular Weight | 294.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cycloprocanazole-d3 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18ClN3O |
|---|---|
| Molecular Weight | 294.79 |
| InChIKey | UFNOUKDBUJZYDE-FIBGUPNXSA-N |
| SMILES | CC(C1CC1)C(O)(Cn1cncn1)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Cycloprocanazole-d3? |
| A: SMILES notation of Cycloprocanazole-d3 is CC(C1CC1)C(O)(Cn1cncn1)c1ccc(Cl)cc1. |
| Q: What is the molecular formula of Cycloprocanazole-d3? |
| A: Molecular formula of Cycloprocanazole-d3 is C15H18ClN3O. |
| Q: What is the Chinese name of 2140327-52-0? |
| A: Chinese name of 2140327-52-0 is 2140327-52-0. |
| Q: What is the English name of Cycloprocanazole-d3? |
| A: The English name of Cycloprocanazole-d3 is Cycloprocanazole-d3. |
| Q: What is the InChIKey of Cycloprocanazole-d3? |
| A: InChIKey of Cycloprocanazole-d3 is UFNOUKDBUJZYDE-FIBGUPNXSA-N. |
| Q: What is the molecular weight of Cycloprocanazole-d3? |
| A: Molecular weight of Cycloprocanazole-d3 is 294.79. |
| Q: What is the CAS number of Cycloprocanazole-d3? |
| A: CAS number of Cycloprocanazole-d3 is 2140327-52-0. |