Oxyfluorfen-d5
Modify Date: 2025-09-09 22:25:25
Oxyfluorfen-d5 structure
|
Common Name | Oxyfluorfen-d5 | ||
|---|---|---|---|---|
| CAS Number | 2140327-69-9 | Molecular Weight | 366.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClF3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Oxyfluorfen-d5 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11ClF3NO4 |
|---|---|
| Molecular Weight | 366.73 |
| InChIKey | OQMBBFQZGJFLBU-ZBJDZAJPSA-N |
| SMILES | CCOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2140327-69-9? |
| A: Chinese name of 2140327-69-9 is 2140327-69-9. |
| Q: What is the CAS number of Oxyfluorfen-d5? |
| A: CAS number of Oxyfluorfen-d5 is 2140327-69-9. |
| Q: What is the molecular formula of Oxyfluorfen-d5? |
| A: Molecular formula of Oxyfluorfen-d5 is C15H11ClF3NO4. |
| Q: What is the InChIKey of Oxyfluorfen-d5? |
| A: InChIKey of Oxyfluorfen-d5 is OQMBBFQZGJFLBU-ZBJDZAJPSA-N. |
| Q: What is the SMILES notation of Oxyfluorfen-d5? |
| A: SMILES notation of Oxyfluorfen-d5 is CCOc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-]. |
| Q: What is the molecular weight of Oxyfluorfen-d5? |
| A: Molecular weight of Oxyfluorfen-d5 is 366.73. |
| Q: What is the English name of Oxyfluorfen-d5? |
| A: The English name of Oxyfluorfen-d5 is Oxyfluorfen-d5. |