2-(2,6-dimethoxyphenyl)tellanyl-1,3-dimethoxybenzene structure
|
Common Name | 2-(2,6-dimethoxyphenyl)tellanyl-1,3-dimethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 214050-07-4 | Molecular Weight | 401.91200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O4Te | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,6-dimethoxyphenyl)tellanyl-1,3-dimethoxybenzene |
|---|
| Molecular Formula | C16H18O4Te |
|---|---|
| Molecular Weight | 401.91200 |
| Exact Mass | 404.02700 |
| PSA | 36.92000 |
| LogP | 2.62720 |
| InChIKey | HXRFULYVKFTJIR-UHFFFAOYSA-N |
| SMILES | COc1cccc(OC)c1[Te]c1c(OC)cccc1OC |
|
~%
2-(2,6-dimethox... CAS#:214050-07-4 |
| Literature: Wada, Masanori; Nobuki, Shin-Ichi; Tenkyuu, Yoshinori; Natsume, Satoko; Asahara, Masahiro; Erabi, Tatsuo Journal of Organometallic Chemistry, 1999 , vol. 580, # 2 p. 282 - 289 |
|
~%
2-(2,6-dimethox... CAS#:214050-07-4 |
| Literature: Wada, Masanori; Nobuki, Shin-Ichi; Tenkyuu, Yoshinori; Natsume, Satoko; Asahara, Masahiro; Erabi, Tatsuo Journal of Organometallic Chemistry, 1999 , vol. 580, # 2 p. 282 - 289 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |