1-benzenesulfonyl-5-ethyl-5-phenylhydantoin structure
|
Common Name | 1-benzenesulfonyl-5-ethyl-5-phenylhydantoin | ||
|---|---|---|---|---|
| CAS Number | 21413-25-2 | Molecular Weight | 344.38500 | |
| Density | 1.343g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzenesulfonyl)-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.38500 |
| Exact Mass | 344.08300 |
| PSA | 95.42000 |
| LogP | 3.52720 |
| Index of Refraction | 1.612 |
| InChIKey | HWWVPVUGOLNSEB-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)N1S(=O)(=O)c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzenesulfonyl-5-ethyl-5-phenylhydantoin |
| BSEPH |
| 1-benzenesulfonyl-5-ethyl-5-phenyl-imidazolidine-2,4-dione |