Phthalic acid hydrogen 1-(2-butoxyethyl) ester structure
|
Common Name | Phthalic acid hydrogen 1-(2-butoxyethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 21415-07-6 | Molecular Weight | 265.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17O5- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-butoxyethoxycarbonyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17O5- |
|---|---|
| Molecular Weight | 265.28200 |
| Exact Mass | 265.10800 |
| PSA | 75.66000 |
| LogP | 1.02360 |
| InChIKey | FYEDNKVJQMKJTP-UHFFFAOYSA-M |
| SMILES | CCCCOCCOC(=O)c1ccccc1C(=O)[O-] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butoxyaethylphthalat |