methyl 2-(1H-indol-2-yl)acetate
methyl 2-(1H-indol-2-yl)acetate structure
|
Common Name | methyl 2-(1H-indol-2-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 21422-40-2 | Molecular Weight | 189.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-(1H-indol-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO2 |
|---|---|
| Molecular Weight | 189.21100 |
| Exact Mass | 189.07900 |
| PSA | 42.09000 |
| LogP | 1.88340 |
| InChIKey | ZXAOWDBYBUEVKE-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1cc2ccccc2[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 1 | |
CAS#:67-56-1
CAS#:201230-82-2
CAS#:78839-85-7
CAS#:5837-72-9
CAS#:186581-53-3
CAS#:32588-36-6
CAS#:2727-71-1
CAS#:615-36-1
CAS#:33588-57-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl indole-2-acetate |
| 2-indole methyl acetate |
| methyl 1H-indole-2-acetate |
| methyl ester of indole 2-acetic acid |
| indole-2-acetic acid methyl ester |
| Methyl 2-indoleacetate |
| 1H-Indole-2-acetic acid,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of methyl 2-(1H-indol-2-yl)acetate? |
| A: Related downstream products(CAS) of methyl 2-(1H-indol-2-yl)acetate: 32588-36-6. |
| Q: What is the polar surface area (PSA) of methyl 2-(1H-indol-2-yl)acetate? |
| A: Polar surface area (PSA) of methyl 2-(1H-indol-2-yl)acetate is 42.09000. |
| Q: What is the molecular weight of methyl 2-(1H-indol-2-yl)acetate? |
| A: Molecular weight of methyl 2-(1H-indol-2-yl)acetate is 189.21100. |
| Q: What is the CAS number of methyl 2-(1H-indol-2-yl)acetate? |
| A: CAS number of methyl 2-(1H-indol-2-yl)acetate is 21422-40-2. |
| Q: What is the English name of methyl 2-(1H-indol-2-yl)acetate? |
| A: The English name of methyl 2-(1H-indol-2-yl)acetate is methyl 2-(1H-indol-2-yl)acetate. |
| Q: What is the InChIKey of methyl 2-(1H-indol-2-yl)acetate? |
| A: InChIKey of methyl 2-(1H-indol-2-yl)acetate is ZXAOWDBYBUEVKE-UHFFFAOYSA-N. |
| Q: What is the LogP of methyl 2-(1H-indol-2-yl)acetate? |
| A: LogP of methyl 2-(1H-indol-2-yl)acetate is 1.88340. |
| Q: What English synonyms does methyl 2-(1H-indol-2-yl)acetate have? |
| A: English synonyms of methyl 2-(1H-indol-2-yl)acetate: methyl indole-2-acetate, 2-indole methyl acetate, methyl 1H-indole-2-acetate, methyl ester of indole 2-acetic acid, indole-2-acetic acid methyl ester, Methyl 2-indoleacetate, 1H-Indole-2-acetic acid,methyl ester. |
| Q: What is the molecular formula of methyl 2-(1H-indol-2-yl)acetate? |
| A: Molecular formula of methyl 2-(1H-indol-2-yl)acetate is C11H11NO2. |
| Q: What is the SMILES notation of methyl 2-(1H-indol-2-yl)acetate? |
| A: SMILES notation of methyl 2-(1H-indol-2-yl)acetate is COC(=O)Cc1cc2ccccc2[nH]1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |