5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid
Modify Date: 2025-11-07 15:08:35
![5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid Structure](https://www.chemsrc.com/extcaspic/177/2142228-29-1.png)
5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid structure
|
Common Name | 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2142228-29-1 | Molecular Weight | 274.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22N2O5 |
|---|---|
| Molecular Weight | 274.31 |
| InChIKey | PPDNYRRDYYYOPT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CCNC(=O)OC(C)(C)C)CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid? |
| A: SMILES notation of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid is CC(=O)NC(CCNC(=O)OC(C)(C)C)CC(=O)O. |
| Q: What is the CAS number of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid? |
| A: CAS number of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid is 2142228-29-1. |
| Q: What is the English name of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid? |
| A: The English name of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid is 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid. |
| Q: What is the molecular weight of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid? |
| A: Molecular weight of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid is 274.31. |
| Q: What is the Chinese name of 2142228-29-1? |
| A: Chinese name of 2142228-29-1 is 2142228-29-1. |
| Q: What is the InChIKey of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid? |
| A: InChIKey of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid is PPDNYRRDYYYOPT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid? |
| A: Molecular formula of 5-{[(Tert-butoxy)carbonyl]amino}-3-acetamidopentanoic acid is C12H22N2O5. |