BPK-29 structure
|
Common Name | BPK-29 | ||
|---|---|---|---|---|
| CAS Number | 2143467-62-1 | Molecular Weight | 470.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H32ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BPK-29BPK-29 is a covalent small molecule that disrupts NR0B1 complexes and impairs the anchorage-independent growth of KEAP1-mutant cancer cells[1]. |
| Name | BPK-29 |
|---|
| Description | BPK-29 is a covalent small molecule that disrupts NR0B1 complexes and impairs the anchorage-independent growth of KEAP1-mutant cancer cells[1]. |
|---|---|
| Related Catalog | |
| In Vitro | BPK-29 substantially engages NR0B1 with good overall proteomic selectivity in KEAP1-mutant Non-Small Cell Lung Cancers[1]. |
| References |
| Molecular Formula | C26H32ClN3O3 |
|---|---|
| Molecular Weight | 470.00 |
| InChIKey | ZKWKNYRAPOSUDO-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(N2CCOCC2)cc1)N1CCCC(N(Cc2ccccc2)C(=O)CCl)CC1 |