Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate
Modify Date: 2026-07-04 10:00:18
Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate structure
|
Common Name | Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 214483-47-3 | Molecular Weight | 348.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H20O4 |
|---|---|
| Molecular Weight | 348.4 |
| InChIKey | RYBSAZOAPFEXIO-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCc2ccccc2)cc(O)c1C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate? |
| A: The English name of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate is Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate. |
| Q: What is the molecular weight of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate? |
| A: Molecular weight of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate is 348.4. |
| Q: What is the CAS number of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate? |
| A: CAS number of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate is 214483-47-3. |
| Q: What is the molecular formula of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate? |
| A: Molecular formula of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate is C22H20O4. |
| Q: What is the Chinese name of 214483-47-3? |
| A: Chinese name of 214483-47-3 is 214483-47-3. |
| Q: What is the SMILES notation of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate? |
| A: SMILES notation of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate is Cc1cc(OCc2ccccc2)cc(O)c1C(=O)OCc1ccccc1. |
| Q: What is the InChIKey of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate? |
| A: InChIKey of Phenylmethyl 2-hydroxy-6-methyl-4-(phenylmethoxy)benzoate is RYBSAZOAPFEXIO-UHFFFAOYSA-N. |