4-(3-ethynylbenzoyl)benzonitrile
4-(3-ethynylbenzoyl)benzonitrile structure
|
Common Name | 4-(3-ethynylbenzoyl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 214548-26-2 | Molecular Weight | 231.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3-ethynylbenzoyl)benzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H9NO |
|---|---|
| Molecular Weight | 231.24900 |
| Exact Mass | 231.06800 |
| PSA | 40.86000 |
| LogP | 2.77058 |
| InChIKey | ASMPYMUVYMCKLY-UHFFFAOYSA-N |
| SMILES | C#Cc1cccc(C(=O)c2ccc(C#N)cc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:243137-98-6
CAS#:585-76-2
CAS#:1711-09-7
CAS#:54118-76-2
CAS#:102092-51-3
CAS#:243137-99-7
CAS#:100-66-3
CAS#:243137-96-4
CAS#:243137-97-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: Molecular weight of 4-(3-ethynylbenzoyl)benzonitrile is 231.24900. |
| Q: What is the InChIKey of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: InChIKey of 4-(3-ethynylbenzoyl)benzonitrile is ASMPYMUVYMCKLY-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: Polar surface area (PSA) of 4-(3-ethynylbenzoyl)benzonitrile is 40.86000. |
| Q: What is the molecular formula of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: Molecular formula of 4-(3-ethynylbenzoyl)benzonitrile is C16H9NO. |
| Q: What is the LogP of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: LogP of 4-(3-ethynylbenzoyl)benzonitrile is 2.77058. |
| Q: What is the English name of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: The English name of 4-(3-ethynylbenzoyl)benzonitrile is 4-(3-ethynylbenzoyl)benzonitrile. |
| Q: What is the CAS number of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: CAS number of 4-(3-ethynylbenzoyl)benzonitrile is 214548-26-2. |
| Q: What is the SMILES notation of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: SMILES notation of 4-(3-ethynylbenzoyl)benzonitrile is C#Cc1cccc(C(=O)c2ccc(C#N)cc2)c1. |
| Q: What is the Chinese name of 214548-26-2? |
| A: Chinese name of 214548-26-2 is 214548-26-2. |
| Q: What are the upstream materials of 4-(3-ethynylbenzoyl)benzonitrile? |
| A: Related upstream materials(CAS) of 4-(3-ethynylbenzoyl)benzonitrile: 243137-98-6;585-76-2;1711-09-7;54118-76-2;102092-51-3;243137-99-7;100-66-3;243137-96-4;243137-97-5. |