Diphenylacetic acid 2-[(2-cyclopentylethyl)amino]ethyl ester structure
|
Common Name | Diphenylacetic acid 2-[(2-cyclopentylethyl)amino]ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21461-69-8 | Molecular Weight | 351.48200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[cyclopentyl(ethyl)amino]ethyl 2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H29NO2 |
|---|---|
| Molecular Weight | 351.48200 |
| Exact Mass | 351.22000 |
| PSA | 29.54000 |
| LogP | 4.62620 |
| Vapour Pressure | 2.14E-09mmHg at 25°C |
| InChIKey | JERLKKGYXRZKQF-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(=O)C(c1ccccc1)c1ccccc1)C1CCCC1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diphenylacetic acid 2-(cyclopentylethylamino)ethyl ester |
| 2-[cyclopentyl(ethyl)amino]ethyl diphenylacetate |
| ACETIC ACID,DIPHENYL-,2-(CYCLOPENTYLETHYLAMINO)ETHYL ESTER |