N-(tert-butoxycarbonyl)-3,5-diiodo-D-tyrosine structure
|
Common Name | N-(tert-butoxycarbonyl)-3,5-diiodo-D-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 214630-08-7 | Molecular Weight | 533.097 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 513.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H17I2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.2±30.1 °C | |
| Name | (2R)-3-(4-hydroxy-3,5-diiodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 513.3±50.0 °C at 760 mmHg |
| Molecular Formula | C14H17I2NO5 |
| Molecular Weight | 533.097 |
| Flash Point | 264.2±30.1 °C |
| Exact Mass | 532.919617 |
| PSA | 95.86000 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | CTUIJSMDTYBOLW-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cc(I)c(O)c(I)c1)C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-Diiodo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-tyrosine |
| D-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-3,5-diiodo- |
| 2-tert-Butoxycarbonylamino-3-(4-hydroxy-3,5-diiodo-phenyl)-propionic acid |
| N-(tert-butoxycarbonyl)-3,5-diiodo-D-tyrosine |
| Boc-3,5-Diiodo-D-tyrosine |