Z-Ala-Asn-OH structure
|
Common Name | Z-Ala-Asn-OH | ||
|---|---|---|---|---|
| CAS Number | 21467-12-9 | Molecular Weight | 337.32800 | |
| Density | 1.337 g/cm3 | Boiling Point | 714.1ºC at 760 mmHg | |
| Molecular Formula | C15H19N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 385.7ºC | |
| Name | 4-amino-4-oxo-2-[2-(phenylmethoxycarbonylamino)propanoylamino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337 g/cm3 |
|---|---|
| Boiling Point | 714.1ºC at 760 mmHg |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.32800 |
| Flash Point | 385.7ºC |
| Exact Mass | 337.12700 |
| PSA | 147.82000 |
| LogP | 1.22820 |
| Vapour Pressure | 2.1E-21mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | HGTVLMHRWVJWOV-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(CC(N)=O)C(=O)O |
|
~%
Z-Ala-Asn-OH CAS#:21467-12-9 |
| Literature: Shiba,T. et al. Bulletin of the Chemical Society of Japan, 1968 , vol. 41, p. 2748 - 2753 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Benzyloxycarbonyl-L-alanyl-L-asparagin |
| Cbz-Ala-Asn-OH |
| Z-Ala-Asn-OH |