Ethane,1,1',1''-[methylidynetris(sulfonyl)]tris- (9CI) structure
|
Common Name | Ethane,1,1',1''-[methylidynetris(sulfonyl)]tris- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 21467-59-4 | Molecular Weight | 292.39300 | |
| Density | 1.408g/cm3 | Boiling Point | 604.6ºC at 760mmHg | |
| Molecular Formula | C7H16O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 424.3ºC | |
| Name | 1-[bis(ethylsulfonyl)methylsulfonyl]ethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 604.6ºC at 760mmHg |
| Molecular Formula | C7H16O6S3 |
| Molecular Weight | 292.39300 |
| Flash Point | 424.3ºC |
| Exact Mass | 292.01100 |
| PSA | 127.56000 |
| LogP | 2.81650 |
| Vapour Pressure | 6.31E-14mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | ZMZMWZJOEIWLQL-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C(S(=O)(=O)CC)S(=O)(=O)CC |
| HS Code | 2904100000 |
|---|
|
~%
Ethane,1,1',1''... CAS#:21467-59-4 |
| Literature: Boehme; Marx Chemische Berichte, 1941 , vol. 74, p. 1673 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Tris-aethansulfonyl-methan |
| tris-ethanesulfonyl-methane |
| Tris-ethylsulfonyl-methan |
| EINECS 244-401-0 |
| Tris-aethylsulfonylmethan |