6-Benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-amine structure
|
Common Name | 6-Benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 214699-26-0 | Molecular Weight | 239.316 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 421.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9±28.7 °C | |
| Name | 6-Benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.8±45.0 °C at 760 mmHg |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.316 |
| Flash Point | 208.9±28.7 °C |
| Exact Mass | 239.142242 |
| PSA | 42.15000 |
| LogP | 1.26 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | LZCBWYQNYNKFFL-UHFFFAOYSA-N |
| SMILES | Nc1cnc2c(c1)CN(Cc1ccccc1)CC2 |
| HS Code | 2933990090 |
|---|
|
~%
6-Benzyl-5,6,7,... CAS#:214699-26-0 |
| Literature: Synthetic Communications, , vol. 31, # 5 p. 787 - 797 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,6-Naphthyridin-3-amine, 5,6,7,8-tetrahydro-6-(phenylmethyl)- |
| 6-benzyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine |
| 3-Amino-6-benzyl-5,6,7,8-tetrahydro-1,6-naphthyridine |
| 6-Benzyl-5,6,7,8-tetrahydro-1,6-naphthyridin-3-amine |