9,10-bis(dibromomethylidene)anthracene structure
|
Common Name | 9,10-bis(dibromomethylidene)anthracene | ||
|---|---|---|---|---|
| CAS Number | 214779-03-0 | Molecular Weight | 519.85100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H8Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9,10-bis(dibromomethylidene)anthracene |
|---|
| Molecular Formula | C16H8Br4 |
|---|---|
| Molecular Weight | 519.85100 |
| Exact Mass | 515.73600 |
| LogP | 5.70400 |
| InChIKey | IQAVUBHBMRSYPP-UHFFFAOYSA-N |
| SMILES | BrC(Br)=c1c2ccccc2c(=C(Br)Br)c2ccccc12 |
|
~96%
9,10-bis(dibrom... CAS#:214779-03-0 |
| Literature: Donovan, Patrick M.; Scott, Lawrence T. Journal of the American Chemical Society, 2004 , vol. 126, # 10 p. 3108 - 3112 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |