2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propan-1-ol structure
|
Common Name | 2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 21482-12-2 | Molecular Weight | 308.41100 | |
| Density | 1.033g/cm3 | Boiling Point | 400.325ºC at 760 mmHg | |
| Molecular Formula | C15H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.91ºC | |
| Name | 2-[2-[2-[2-(2-hydroxypropoxy)propoxy]propoxy]propoxy]propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.033g/cm3 |
|---|---|
| Boiling Point | 400.325ºC at 760 mmHg |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.41100 |
| Flash Point | 195.91ºC |
| Exact Mass | 308.22000 |
| PSA | 77.38000 |
| LogP | 0.97990 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | AQRQHYITOOVBTO-UHFFFAOYSA-N |
| SMILES | CC(O)COC(C)COC(C)COC(C)COC(C)CO |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3,6,9,12-Tetraoxapentadecane-1,14-diol,2,5,8,11-tetramethyl |
| Pentapropyleneglycol (6CI,8CI) |
| polypropylene glycol diol 400 |
| pentapropyleneglycol |