2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one
Modify Date: 2026-07-06 18:24:35
![2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one Structure](https://www.chemsrc.com/extcaspic/016/2149305-69-9.png)
2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one structure
|
Common Name | 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one | ||
|---|---|---|---|---|
| CAS Number | 2149305-69-9 | Molecular Weight | 168.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H4N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4H4N6O2 |
|---|---|
| Molecular Weight | 168.11 |
| InChIKey | ZTVXBZNVGDRUEY-UHFFFAOYSA-N |
| SMILES | Nc1nc2[nH]c(=O)[nH]c(=O)n2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2149305-69-9? |
| A: Chinese name of 2149305-69-9 is 2149305-69-9. |
| Q: What is the SMILES notation of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one? |
| A: SMILES notation of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one is Nc1nc2[nH]c(=O)[nH]c(=O)n2n1. |
| Q: What is the molecular formula of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one? |
| A: Molecular formula of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one is C4H4N6O2. |
| Q: What is the InChIKey of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one? |
| A: InChIKey of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one is ZTVXBZNVGDRUEY-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one? |
| A: Molecular weight of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one is 168.11. |
| Q: What is the English name of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one? |
| A: The English name of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one is 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one. |
| Q: What is the CAS number of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one? |
| A: CAS number of 2-amino-5-hydroxy-4H,7H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one is 2149305-69-9. |