4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride
Modify Date: 2025-09-06 19:15:29
4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride structure
|
Common Name | 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2149591-12-6 | Molecular Weight | 247.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15ClFNO2 |
|---|---|
| Molecular Weight | 247.69 |
| InChIKey | KZCBEDATAUMHEP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(CN)c1ccc(F)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride? |
| A: CAS number of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride is 2149591-12-6. |
| Q: What is the molecular weight of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride? |
| A: Molecular weight of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride is 247.69. |
| Q: What is the SMILES notation of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride? |
| A: SMILES notation of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride is COC(=O)CC(CN)c1ccc(F)cc1.Cl. |
| Q: What is the molecular formula of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride? |
| A: Molecular formula of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride is C11H15ClFNO2. |
| Q: What is the Chinese name of 2149591-12-6? |
| A: Chinese name of 2149591-12-6 is 2149591-12-6. |
| Q: What is the English name of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride? |
| A: The English name of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride is 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride. |
| Q: What is the InChIKey of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride? |
| A: InChIKey of 4-Amino-3-(4-fluorophenyl)butyric acid methyl ester hydrochloride is KZCBEDATAUMHEP-UHFFFAOYSA-N. |