5-Bromo-2-(trifluoromethyl)benzyl acetate
Modify Date: 2026-08-28 16:38:38
5-Bromo-2-(trifluoromethyl)benzyl acetate structure
|
Common Name | 5-Bromo-2-(trifluoromethyl)benzyl acetate | ||
|---|---|---|---|---|
| CAS Number | 2149591-27-3 | Molecular Weight | 297.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-2-(trifluoromethyl)benzyl acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8BrF3O2 |
|---|---|
| Molecular Weight | 297.07 |
| InChIKey | LJHHUQBKFVPPJV-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cc(Br)ccc1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-Bromo-2-(trifluoromethyl)benzyl acetate? |
| A: InChIKey of 5-Bromo-2-(trifluoromethyl)benzyl acetate is LJHHUQBKFVPPJV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-Bromo-2-(trifluoromethyl)benzyl acetate? |
| A: CAS number of 5-Bromo-2-(trifluoromethyl)benzyl acetate is 2149591-27-3. |
| Q: What is the Chinese name of 2149591-27-3? |
| A: Chinese name of 2149591-27-3 is 2149591-27-3. |
| Q: What is the English name of 5-Bromo-2-(trifluoromethyl)benzyl acetate? |
| A: The English name of 5-Bromo-2-(trifluoromethyl)benzyl acetate is 5-Bromo-2-(trifluoromethyl)benzyl acetate. |
| Q: What is the SMILES notation of 5-Bromo-2-(trifluoromethyl)benzyl acetate? |
| A: SMILES notation of 5-Bromo-2-(trifluoromethyl)benzyl acetate is CC(=O)OCc1cc(Br)ccc1C(F)(F)F. |
| Q: What is the molecular weight of 5-Bromo-2-(trifluoromethyl)benzyl acetate? |
| A: Molecular weight of 5-Bromo-2-(trifluoromethyl)benzyl acetate is 297.07. |
| Q: What is the molecular formula of 5-Bromo-2-(trifluoromethyl)benzyl acetate? |
| A: Molecular formula of 5-Bromo-2-(trifluoromethyl)benzyl acetate is C10H8BrF3O2. |