3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide
Modify Date: 2025-08-26 17:17:13
3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide structure
|
Common Name | 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide | ||
|---|---|---|---|---|
| CAS Number | 214971-26-3 | Molecular Weight | 311.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21N3O3S |
|---|---|
| Molecular Weight | 311.40 |
| InChIKey | ZELPWHGCHCJLIO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(S(=O)(=O)N=[N+]=[N-])cc(C(C)(C)C)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide? |
| A: SMILES notation of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide is CC(C)(C)c1cc(S(=O)(=O)N=[N+]=[N-])cc(C(C)(C)C)c1O. |
| Q: What is the Chinese name of 214971-26-3? |
| A: Chinese name of 214971-26-3 is 214971-26-3. |
| Q: What is the CAS number of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide? |
| A: CAS number of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide is 214971-26-3. |
| Q: What is the InChIKey of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide? |
| A: InChIKey of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide is ZELPWHGCHCJLIO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide? |
| A: Molecular weight of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide is 311.40. |
| Q: What is the English name of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide? |
| A: The English name of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide is 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide. |
| Q: What is the molecular formula of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide? |
| A: Molecular formula of 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzenesulfonyl azide is C14H21N3O3S. |