Carbamic acid,(2,3-dichlorophenyl)-, 1-methylethyl ester (9CI) structure
|
Common Name | Carbamic acid,(2,3-dichlorophenyl)-, 1-methylethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 2150-24-5 | Molecular Weight | 248.10600 | |
| Density | 1.332g/cm3 | Boiling Point | 277.4ºC at 760mmHg | |
| Molecular Formula | C10H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.6ºC | |
| Name | Carbamic acid,(2,3-dichlorophenyl)-, 1-methylethyl ester (9CI) |
|---|
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 277.4ºC at 760mmHg |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.10600 |
| Flash Point | 121.6ºC |
| Exact Mass | 247.01700 |
| PSA | 38.33000 |
| LogP | 4.02330 |
| Vapour Pressure | 0.00454mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | UXEAHIFQYGDANS-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1cccc(Cl)c1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |