3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine
Modify Date: 2025-09-11 12:57:50
![3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine Structure](https://www.chemsrc.com/extcaspic/198/2151835-19-5.png)
3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine structure
|
Common Name | 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 2151835-19-5 | Molecular Weight | 266.02 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3BrF3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3BrF3N3 |
|---|---|
| Molecular Weight | 266.02 |
| InChIKey | HWPQMUDFPASHHX-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ncc2ncc(Br)cn12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine? |
| A: Molecular weight of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine is 266.02. |
| Q: What is the molecular formula of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine? |
| A: Molecular formula of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine is C7H3BrF3N3. |
| Q: What is the SMILES notation of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine? |
| A: SMILES notation of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine is FC(F)(F)c1ncc2ncc(Br)cn12. |
| Q: What is the English name of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine? |
| A: The English name of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine is 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine. |
| Q: What is the InChIKey of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine? |
| A: InChIKey of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine is HWPQMUDFPASHHX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2151835-19-5? |
| A: Chinese name of 2151835-19-5 is 2151835-19-5. |
| Q: What is the CAS number of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine? |
| A: CAS number of 3-Bromo-6-(trifluoromethyl)imidazo[1,5-a]pyrimidine is 2151835-19-5. |