terpinyl butyrate structure
|
Common Name | terpinyl butyrate | ||
|---|---|---|---|---|
| CAS Number | 2153-28-8 | Molecular Weight | 224.33900 | |
| Density | 0.938 g/mL at 25ºC(lit.) | Boiling Point | 277.3ºC at 760 mmHg | |
| Molecular Formula | C14H24O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | >230 °F | |
| Name | 2-(4-methylcyclohex-3-en-1-yl)propan-2-yl butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.938 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 277.3ºC at 760 mmHg |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.33900 |
| Flash Point | >230 °F |
| Exact Mass | 224.17800 |
| PSA | 26.30000 |
| LogP | 3.85470 |
| Vapour Pressure | 0.00456mmHg at 25°C |
| Index of Refraction | n20/D 1.4650(lit.) |
| InChIKey | LWKWNIYBQLKBMQ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC(C)(C)C1CC=C(C)CC1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2930200015 |
| HS Code | 2930200015 |
|---|---|
| Summary | 2930200015 butyrate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
| butyric acid p-menth-1-en-8-yl ester |
| Terpinyl butyrate |
| Buttersaeure-p-menth-1-en-8-ylester |
| terpinyl butylate |
| UNII-L94B6AU40N |