3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine
Modify Date: 2025-09-17 11:24:00
3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine structure
|
Common Name | 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2153206-44-9 | Molecular Weight | 203.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10F5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10F5N |
|---|---|
| Molecular Weight | 203.15 |
| InChIKey | UYCWYYVRRVVYRS-UHFFFAOYSA-N |
| SMILES | NC1(CCC(F)(F)F)CC(F)(F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine? |
| A: Molecular weight of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine is 203.15. |
| Q: What is the InChIKey of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine? |
| A: InChIKey of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine is UYCWYYVRRVVYRS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2153206-44-9? |
| A: Chinese name of 2153206-44-9 is 2153206-44-9. |
| Q: What is the molecular formula of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine? |
| A: Molecular formula of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine is C7H10F5N. |
| Q: What is the English name of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine? |
| A: The English name of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine is 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine. |
| Q: What is the SMILES notation of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine? |
| A: SMILES notation of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine is NC1(CCC(F)(F)F)CC(F)(F)C1. |
| Q: What is the CAS number of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine? |
| A: CAS number of 3,3-Difluoro-1-(3,3,3-trifluoropropyl)cyclobutan-1-amine is 2153206-44-9. |