2-[4-(3-NITRO-2-PYRIDYL)PIPERAZINO]ETHAN-1-OL structure
|
Common Name | 2-[4-(3-NITRO-2-PYRIDYL)PIPERAZINO]ETHAN-1-OL | ||
|---|---|---|---|---|
| CAS Number | 215434-62-1 | Molecular Weight | 252.27000 | |
| Density | 1.307g/cm3 | Boiling Point | 443.3ºC at 760mmHg | |
| Molecular Formula | C11H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.9ºC | |
| Name | 2-[4-(3-nitropyridin-2-yl)piperazin-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307g/cm3 |
|---|---|
| Boiling Point | 443.3ºC at 760mmHg |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27000 |
| Flash Point | 221.9ºC |
| Exact Mass | 252.12200 |
| PSA | 85.42000 |
| LogP | 0.63020 |
| Vapour Pressure | 1.22E-08mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | SQZXOFMVKVJHBQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccnc1N1CCN(CCO)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[4-(3-nitro-2-pyridyl)piperazino]ethan-1-ol |
| hms542k01 |