1-(2-chloroethyl)-3-(2,6-diethylphenyl)urea structure
|
Common Name | 1-(2-chloroethyl)-3-(2,6-diethylphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 21548-54-9 | Molecular Weight | 254.75600 | |
| Density | 1.132g/cm3 | Boiling Point | 350.9ºC at 760 mmHg | |
| Molecular Formula | C13H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166ºC | |
| Name | 1-(2-chloroethyl)-3-(2,6-diethylphenyl)urea |
|---|
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 350.9ºC at 760 mmHg |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.75600 |
| Flash Point | 166ºC |
| Exact Mass | 254.11900 |
| PSA | 41.13000 |
| LogP | 3.63560 |
| Vapour Pressure | 4.25E-05mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | OINDQNQEWUMFMS-UHFFFAOYSA-N |
| SMILES | CCc1cccc(CC)c1NC(=O)NCCCl |
|
~%
1-(2-chloroethy... CAS#:21548-54-9 |
| Literature: Bechard; Lacroix; Poyet; C-Gaudreault European Journal of Medicinal Chemistry, 1994 , vol. 29, # 12 p. 963 - 966 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |