Carbamic acid, (a,a-dimethylphenethyl)-, ethyl ester (7CI,8CI) structure
|
Common Name | Carbamic acid, (a,a-dimethylphenethyl)-, ethyl ester (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 21552-58-9 | Molecular Weight | 221.29500 | |
| Density | 1.019g/cm3 | Boiling Point | 338.1ºC at 760mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3ºC | |
| Name | ethyl N-(2-methyl-1-phenylpropan-2-yl)carbamate |
|---|
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 338.1ºC at 760mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 158.3ºC |
| Exact Mass | 221.14200 |
| PSA | 38.33000 |
| LogP | 3.14470 |
| Vapour Pressure | 0.0001mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | MZHYGGYUFBUFDV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(C)(C)Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |