3-(3-ethylphenyl)-1-methyl-1-nitrosourea structure
|
Common Name | 3-(3-ethylphenyl)-1-methyl-1-nitrosourea | ||
|---|---|---|---|---|
| CAS Number | 21562-04-9 | Molecular Weight | 207.22900 | |
| Density | 1.16g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3-ethylphenyl)-1-methyl-1-nitrosourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.22900 |
| Exact Mass | 207.10100 |
| PSA | 65.26000 |
| LogP | 2.40770 |
| Index of Refraction | 1.558 |
| InChIKey | LYRCSZIMZINJBC-UHFFFAOYSA-N |
| SMILES | CCc1cccc(NC(=O)N(C)N=O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Urea,3-(m-ethylphenyl)-1-methyl-1-nitroso |
| 3-<3-Aethyl-phenyl>1-methyl-1-nitroso-harnstoff |
| N-<3-Aethyl-phenyl>-N'-methyl-N'-nitroso-harnstoff |
| 3-(m-Ethylphenyl)-1-methyl-1-nitrosourea |