tert-butyl (2-(3-phenylureido)ethyl)carbamate structure
|
Common Name | tert-butyl (2-(3-phenylureido)ethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 215654-49-2 | Molecular Weight | 279.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl (2-(3-phenylureido)ethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21N3O3 |
|---|---|
| Molecular Weight | 279.33500 |
| Exact Mass | 279.15800 |
| PSA | 79.46000 |
| LogP | 3.18760 |
| InChIKey | YAVPFCYBCGSNJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)Nc1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| tert-butyl 2-(3-phenylureido)ethylcarbamate |