4-hydroxynonachlorodiphenyl ether structure
|
Common Name | 4-hydroxynonachlorodiphenyl ether | ||
|---|---|---|---|---|
| CAS Number | 21567-21-5 | Molecular Weight | 496.21200 | |
| Density | 1.865g/cm3 | Boiling Point | 444.6ºC at 760mmHg | |
| Molecular Formula | C12HCl9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | 2,3,5,6-tetrachloro-4-(2,3,4,5,6-pentachlorophenoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.865g/cm3 |
|---|---|
| Boiling Point | 444.6ºC at 760mmHg |
| Molecular Formula | C12HCl9O2 |
| Molecular Weight | 496.21200 |
| Flash Point | 222.7ºC |
| Exact Mass | 491.71700 |
| PSA | 29.46000 |
| LogP | 9.06510 |
| Vapour Pressure | 1.61E-08mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | ZVVFIXFTAITHQK-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)c(Cl)c(Oc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| HS Code | 2909500000 |
|---|
|
~52%
4-hydroxynonach... CAS#:21567-21-5 |
| Literature: Campbell, Jo-Anne B; Deinzer, Max L.; Miller, Terry L.; Rohrer, Douglas C.; Strong, Phyllis, E. Journal of Organic Chemistry, 1982 , vol. 47, # 25 p. 4968 - 4970 |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3,5,6-Tetrachlor-4-pentachlorphenoxy-phenol |
| 4-Hydroxy-nonachlorodiphenyl ether |
| 2,3,5,6-tetrachloro-4-pentachlorophenoxy-phenol |
| Phenol,2,3,5,6-tetrachloro-4-(pentachlorophenoxy) |
| tetrachloro-4-(pentachlorophenoxy)phenol |
| 4-Hydroxy-nonachlordiphenyl-aether |
| Nonachloro-4-phenoxyphenol |