1,1,2,3,4,4,4-heptafluoro-3-(trifluoromethyl)but-1-ene structure
|
Common Name | 1,1,2,3,4,4,4-heptafluoro-3-(trifluoromethyl)but-1-ene | ||
|---|---|---|---|---|
| CAS Number | 21581-82-8 | Molecular Weight | 250.03800 | |
| Density | 1.573g/cm3 | Boiling Point | 27.6ºC at 760mmHg | |
| Molecular Formula | C5F10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,3,4,4,4-heptafluoro-3-(trifluoromethyl)but-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 27.6ºC at 760mmHg |
| Molecular Formula | C5F10 |
| Molecular Weight | 250.03800 |
| Exact Mass | 249.98400 |
| LogP | 3.89690 |
| Vapour Pressure | 692mmHg at 25°C |
| Index of Refraction | 1.264 |
| InChIKey | CPAQQPJFMVGXBQ-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(C(F)(F)F)C(F)(F)F |
| HS Code | 2903399090 |
|---|
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Perfluor-3-methylbut-1-en |
| perfluoro-2-methylbut-1-ene |
| decafluoro-3-methyl-1-butene |
| 1,1,2,3,4,4,4-heptafluoro-3-trifluoromethyl-but-1-ene |
| Perfluoro-3-methylbut-1-ene |
| EINECS 244-455-5 |