Carbamicacid, [[2-(4-morpholinyl)-1-cyclopenten-1-yl]thioxomethyl]-, ethyl ester (9CI) structure
|
Common Name | Carbamicacid, [[2-(4-morpholinyl)-1-cyclopenten-1-yl]thioxomethyl]-, ethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 21582-59-2 | Molecular Weight | 284.37500 | |
| Density | 1.265g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-(2-morpholin-4-ylcyclopentene-1-carbothioyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.37500 |
| Exact Mass | 284.11900 |
| PSA | 82.89000 |
| LogP | 2.15890 |
| Index of Refraction | 1.586 |
| InChIKey | DQTLDNFSGVCWAR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(=S)C1=C(N2CCOCC2)CCC1 |
|
~94%
Carbamicacid, [... CAS#:21582-59-2 |
| Literature: Uher, Michal; Foltin, Jozef; Floch, Lubomir Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 11 p. 2696 - 2702 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2-morpholin-4-yl-cyclopent-1-enecarbothioyl)-carbamic acid ethyl ester |
| ethyl [2-(4-morpholinyl)-1-cyclopenten-1-yl]carbothioylcarbamate |
| 1-(N-Carbethoxy-thiocarbamoyl)-2-morpholino-cyclopenten |