2-(4-aminophenyl)-4,5,6-trichloropyridazin-3-one structure
|
Common Name | 2-(4-aminophenyl)-4,5,6-trichloropyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 21583-77-7 | Molecular Weight | 290.53300 | |
| Density | 1.66g/cm3 | Boiling Point | 412.6ºC at 760mmHg | |
| Molecular Formula | C10H6Cl3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | 2-(4-aminophenyl)-4,5,6-trichloropyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Boiling Point | 412.6ºC at 760mmHg |
| Molecular Formula | C10H6Cl3N3O |
| Molecular Weight | 290.53300 |
| Flash Point | 203.3ºC |
| Exact Mass | 288.95800 |
| PSA | 60.91000 |
| LogP | 3.35610 |
| Vapour Pressure | 5.11E-07mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | DACHTFAAGHUYRF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-n2nc(Cl)c(Cl)c(Cl)c2=O)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-p-Aminophenyl-3,4,5-trichlor-6-pyridazon |
| Aptcpz |