3',4'-Dimethylbenzophenone-2-carboxylic Acid structure
|
Common Name | 3',4'-Dimethylbenzophenone-2-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 2159-42-4 | Molecular Weight | 254.28100 | |
| Density | 1.195 g/cm3 | Boiling Point | 468.6ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 168ºC | |
| MSDS | N/A | Flash Point | 251.3ºC | |
| Name | 2-(3,4-dimethylbenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195 g/cm3 |
|---|---|
| Boiling Point | 468.6ºC at 760 mmHg |
| Melting Point | 168ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 251.3ºC |
| Exact Mass | 254.09400 |
| PSA | 54.37000 |
| LogP | 3.23260 |
| Vapour Pressure | 1.39E-09mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | AYVFSZDAFPVJOA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)O)cc1C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(3,4-Dimethylbenzoyl)benzoic Acid |
| 3',4'-DiMethylbenzophenone-2-carboxylic Acid |
| 2-(3,4-DIMETHYL-BENZOYL)-BENZOIC ACID |