2-benzoyl-5-methoxy-benzoic acid structure
|
Common Name | 2-benzoyl-5-methoxy-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2159-48-0 | Molecular Weight | 256.25300 | |
| Density | 1.255g/cm3 | Boiling Point | 477.6ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | 2-benzoyl-5-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 477.6ºC at 760 mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 183.5ºC |
| Exact Mass | 256.07400 |
| PSA | 63.60000 |
| LogP | 2.62440 |
| Vapour Pressure | 6.25E-10mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | NTVAYOXZDORJJU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1 |
|
~10%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: MERCK and CO., INC. Patent: WO2005/30727 A1, 2005 ; Location in patent: Page/Page column 23 ; WO 2005/030727 A1 |
|
~%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: SANOFI-AVENTIS Patent: US2007/99895 A1, 2007 ; Location in patent: Page/Page column 9 ; |
|
~70%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: Miao, Jinmin; Ge, Haibo Organic Letters, 2013 , vol. 15, # 12 p. 2930 - 2933 |
|
~%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: Weizmann; Bergmann; Bergmann Journal of the Chemical Society, 1935 , p. 1367,1368, 1369 |
| 2-benzoyl-5-methoxy-benzoic acid |
| 2-Benzoyl-5-methoxy-benzoesaeure |
| 2-benzoyl-5-mnethoxybenzoic acid |
| 5-Methoxy-2-benzoyl-benzoesaeure |