2-benzoyl-5-methoxy-benzoic acid
2-benzoyl-5-methoxy-benzoic acid structure
|
Common Name | 2-benzoyl-5-methoxy-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2159-48-0 | Molecular Weight | 256.25300 | |
| Density | 1.255g/cm3 | Boiling Point | 477.6ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
Summary: 2-Benzoyl-5-methoxybenzoic acid (Chinese name: 2-苯甲酰基-5-甲氧基苯甲酸)，CAS number: 2159-48-0, molecular formula: C15H12O4, molecular weight: 256.25300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-benzoyl-5-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 477.6ºC at 760 mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 183.5ºC |
| Exact Mass | 256.07400 |
| PSA | 63.60000 |
| LogP | 2.62440 |
| Vapour Pressure | 6.25E-10mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | NTVAYOXZDORJJU-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2)c(C(=O)O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~10%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: MERCK and CO., INC. Patent: WO2005/30727 A1, 2005 ; Location in patent: Page/Page column 23 ; WO 2005/030727 A1 |
|
~%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: SANOFI-AVENTIS Patent: US2007/99895 A1, 2007 ; Location in patent: Page/Page column 9 ; |
|
~70%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: Miao, Jinmin; Ge, Haibo Organic Letters, 2013 , vol. 15, # 12 p. 2930 - 2933 |
|
~%
2-benzoyl-5-met... CAS#:2159-48-0 |
| Literature: Weizmann; Bergmann; Bergmann Journal of the Chemical Society, 1935 , p. 1367,1368, 1369 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-benzoyl-5-methoxy-benzoic acid |
| 2-Benzoyl-5-methoxy-benzoesaeure |
| 2-benzoyl-5-mnethoxybenzoic acid |
| 5-Methoxy-2-benzoyl-benzoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-benzoyl-5-methoxybenzoic acid? |
| A: InChIKey of 2-benzoyl-5-methoxybenzoic acid is NTVAYOXZDORJJU-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-benzoyl-5-methoxybenzoic acid? |
| A: Polar surface area (PSA) of 2-benzoyl-5-methoxybenzoic acid is 63.60000. |
| Q: What is the LogP of 2-benzoyl-5-methoxybenzoic acid? |
| A: LogP of 2-benzoyl-5-methoxybenzoic acid is 2.62440. |
| Q: What is the Chinese name of 2159-48-0? |
| A: Chinese name of 2159-48-0 is 2159-48-0. |
| Q: What is the boiling point of 2-benzoyl-5-methoxybenzoic acid? |
| A: Boiling point of 2-benzoyl-5-methoxybenzoic acid is 477.6ºC at 760 mmHg. |
| Q: What English synonyms does 2-benzoyl-5-methoxybenzoic acid have? |
| A: English synonyms of 2-benzoyl-5-methoxybenzoic acid: 2-benzoyl-5-methoxy-benzoic acid, 2-Benzoyl-5-methoxy-benzoesaeure, 2-benzoyl-5-mnethoxybenzoic acid, 5-Methoxy-2-benzoyl-benzoesaeure. |
| Q: What is the English name of 2-benzoyl-5-methoxybenzoic acid? |
| A: The English name of 2-benzoyl-5-methoxybenzoic acid is 2-benzoyl-5-methoxybenzoic acid. |
| Q: What is the molecular formula of 2-benzoyl-5-methoxybenzoic acid? |
| A: Molecular formula of 2-benzoyl-5-methoxybenzoic acid is C15H12O4. |
| Q: What is the molecular weight of 2-benzoyl-5-methoxybenzoic acid? |
| A: Molecular weight of 2-benzoyl-5-methoxybenzoic acid is 256.25300. |
| Q: What is the CAS number of 2-benzoyl-5-methoxybenzoic acid? |
| A: CAS number of 2-benzoyl-5-methoxybenzoic acid is 2159-48-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |