6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one
Modify Date: 2026-08-11 10:07:55
![6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one Structure](https://www.chemsrc.com/extcaspic/059/21594-53-6.png)
6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one structure
|
Common Name | 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one | ||
|---|---|---|---|---|
| CAS Number | 21594-53-6 | Molecular Weight | 271.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9N3O4 |
|---|---|
| Molecular Weight | 271.23 |
| InChIKey | MRXWMKLICSJALZ-UHFFFAOYSA-N |
| SMILES | O=c1nc2n(Cc3ccccc3)cc([N+](=O)[O-])cc-2o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one? |
| A: InChIKey of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one is MRXWMKLICSJALZ-UHFFFAOYSA-N. |
| Q: What is the English name of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one? |
| A: The English name of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one is 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one. |
| Q: What is the CAS number of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one? |
| A: CAS number of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one is 21594-53-6. |
| Q: What is the SMILES notation of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one? |
| A: SMILES notation of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one is O=c1nc2n(Cc3ccccc3)cc([N+](=O)[O-])cc-2o1. |
| Q: What is the molecular weight of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one? |
| A: Molecular weight of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one is 271.23. |
| Q: What is the molecular formula of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one? |
| A: Molecular formula of 6-Nitro-4-(phenylmethyl)oxazolo[4,5-b]pyridin-2(4H)-one is C13H9N3O4. |
| Q: What is the Chinese name of 21594-53-6? |
| A: Chinese name of 21594-53-6 is 21594-53-6. |