Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate
Modify Date: 2026-08-05 15:43:19
Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate structure
|
Common Name | Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 21597-76-2 | Molecular Weight | 210.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10O5 |
|---|---|
| Molecular Weight | 210.18 |
| InChIKey | OTUDVHUSMNQBFO-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=CC(=O)C(=O)C(O)=C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate? |
| A: SMILES notation of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate is CCCOC(=O)C1=CC(=O)C(=O)C(O)=C1. |
| Q: What is the English name of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate? |
| A: The English name of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate is Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate. |
| Q: What is the Chinese name of 21597-76-2? |
| A: Chinese name of 21597-76-2 is 21597-76-2. |
| Q: What is the CAS number of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate? |
| A: CAS number of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate is 21597-76-2. |
| Q: What is the InChIKey of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate? |
| A: InChIKey of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate is OTUDVHUSMNQBFO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate? |
| A: Molecular formula of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate is C10H10O5. |
| Q: What is the molecular weight of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate? |
| A: Molecular weight of Propyl 5-hydroxy-3,4-dioxo-1,5-cyclohexadiene-1-carboxylate is 210.18. |